What is the formula of phenyl acetic acid?
Table of Contents
What is the formula of phenyl acetic acid?
C8H8O2Phenylacetic acid / Formula
What is the structure of 2 phenyl acetic acid?
Phenylacetate
| PubChem CID | 4409936 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C8H7O2- |
| Synonyms | phenylacetate 2-phenylacetate 2-phenylethanoate Benzeneacetate phenylacetate anion More… |
| Molecular Weight | 135.14 |
What is the Iupac name of phenyl acetic acid?
2-phenylacetic acid
| IUPAC Name | 2-phenylacetic acid |
|---|---|
| Alternative Names | PHENYLACETIC ACID Benzeneacetic acid 2-Phenylacetic acid alpha-Toluic acid Phenylethanoic acid |
| Molecular Formula | C8H8O2 |
| Molar Mass | 136.15 g/mol |
| InChI | InChI=1S/C8H8O2/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10) |
What is the name of Phcooh?
Benzoic acid
| Names | |
|---|---|
| Other names Carboxybenzene E210 Dracylic acid Phenylmethanoic acid BzOH | |
| Identifiers | |
| CAS Number | 65-85-0 |
| 3D model (JSmol) | Interactive image |
What is the structure of phenyl acetate?
C8H8O2Phenyl acetate / Formula
Is phenyl acetic acid an aromatic acid?
Phenylacetic acid, also known as phenylacetate or alpha-toluic acid, belongs to the class of organic compounds known as benzene and substituted derivatives. These are aromatic compounds containing one monocyclic ring system consisting of benzene.
What is the molecular formula of phenyl group?
C6H5
The phenyl group or phenyl ring is a cyclic group of atoms with the formula (C6H5) in organic chemistry. another object or combination. which can serve as a working group. Six carbon atoms are grouped in a hexagonal planar ring in phenyl groups, five of which are bound to separate hydrogen atoms.
Is phenyl acetic acid and aromatic carboxylic acid?
Solution. Yes, phenyl acetic acid is a side-chain aromatic carboxylic acid.
What functional group is phenyl acetate?
Phenylacetic acid is an organic compound containing a phenyl functional group and a carboxylic acid functional group. It is a white solid with a disagreeable odor.
Is phenyl acetic acid an aromatic carboxylic acid?
1 Answer. Phenylacetic acid is not an aromatic carboxylic acid.
Is phenyl acetic acid and aromatic carboxylic acid answer?
What is the phenyl formula?
A cyclic group of atoms with formula C6H5 is a phenyl group or phenyl ring. Phenyl groups are closely related to benzene and can be described as a benzene ring, minus a hydrogen, which can be substituted as a functional group by any other element or compound.
What is phenyl structure?
Phenyl groups are closely related to benzene and can be described as a benzene ring, minus a hydrogen, which can be substituted as a functional group by any other element or compound. Phenyl groups have six carbon atoms in a hexagonal planar structure, of which five are bonded to hydrogen atoms.
Is phenyl acetic acid and aromatic carboxylic acid one sentence?
What is structure of phenyl acetate?
